CAS 1221724-84-0

1H-Benzimidazole-5-carboxylic acid, 1,2-dimethyl-, hydrochloride (1:1)

Description:

1H-Benzimidazole-5-carboxylic acid, 1,2-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a carboxylic acid functional group and two methyl groups attached to the imidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the carboxylic acid group suggests potential acidic behavior, while the benzimidazole structure is known for its biological activity, often associated with antimicrobial and antifungal properties. The compound's molecular interactions may be influenced by the presence of the methyl groups, which can affect its steric and electronic properties. Overall, this substance is of interest in medicinal chemistry and may serve as a precursor or active ingredient in drug development.

Formula: C₁₀H₁₀N₂O₂·ClH

InChI: InChI=1S/C10H10N2O2.ClH/c1-6-11-8-5-7(10(13)14)3-4-9(8)12(6)2;/h3-5H,1-2H3,(H,13,14);1H

InChI key: InChIKey=LFGSEGRPUIJPJD-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(C(O)=O)=CC2)N=C1C.Cl

Synonyms:

• 1H-Benzimidazole-5-carboxylic acid, 1,2-dimethyl-, hydrochloride (1:1)

1,2-Dimethyl-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride

CAS: 1221724-84-0

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 226.66 g/mol

Ref: 3D-WYB72484