CAS 1221725-15-0

2,2,2-Trifluoroethyl N-(6-chloro-3,4-dihydro-3-oxo-2H-1,4-benzoxazin-7-yl)carbamate

Description:

2,2,2-Trifluoroethyl N-(6-chloro-3,4-dihydro-3-oxo-2H-1,4-benzoxazin-7-yl)carbamate is a chemical compound characterized by its complex structure, which includes a trifluoroethyl group and a benzoxazine moiety. The presence of the trifluoroethyl group imparts unique properties, such as increased lipophilicity and potential biological activity. The carbamate functional group suggests that it may exhibit reactivity typical of carbamates, including potential hydrolysis under certain conditions. The compound's chlorinated benzoxazine structure may contribute to its stability and influence its interaction with biological targets. This compound is likely to be of interest in pharmaceutical research, particularly in the development of agrochemicals or pharmaceuticals due to its potential herbicidal or pesticidal properties. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact.

Formula: C₁₁H₈ClF₃N₂O₄

InChI: InChI=1S/C11H8ClF3N2O4/c12-5-1-7-8(20-3-9(18)16-7)2-6(5)17-10(19)21-4-11(13,14)15/h1-2H,3-4H2,(H,16,18)(H,17,19)

InChI key: InChIKey=ZFCSTJKHDQUMGO-UHFFFAOYSA-N

SMILES: ClC=1C=C2C(=CC1NC(OCC(F)(F)F)=O)OCC(=O)N2

Synonyms:

• Carbamic acid, N-(6-chloro-3,4-dihydro-3-oxo-2H-1,4-benzoxazin-7-yl)-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-(6-chloro-3,4-dihydro-3-oxo-2H-1,4-benzoxazin-7-yl)carbamate
• 2,2,2-Trifluoroethyl N-(6-chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-7-yl)carbamate

2,2,2-Trifluoroethyl N-(6-chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-7-yl)carbamate

CAS: 1221725-15-0

Versatile small molecule scaffold

Formula: C₁₁H₈ClF₃N₂O₄

Purity: Min. 95%

Molecular weight: 324.64 g/mol

Ref: 3D-WYB72515