CAS 1221725-20-7

Hydrazine, (2-methyl-5-nitrophenyl)-, hydrochloride (1:2)

Description:

Hydrazine, (2-methyl-5-nitrophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and use in various applications, including as a reducing agent and in the synthesis of pharmaceuticals. The presence of the 2-methyl-5-nitrophenyl moiety contributes to its unique properties, potentially influencing its solubility, stability, and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in aqueous environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry, although specific biological effects would depend on its structure and the context of its use. Safety considerations are paramount, as hydrazine derivatives can be toxic and potentially carcinogenic. Proper handling and storage protocols should be followed to mitigate risks associated with exposure. Overall, this compound represents a specialized chemical with potential applications in research and industry, necessitating careful study and evaluation.

Formula: C₇H₉N₃O₂·2ClH

InChI: InChI=1S/C7H9N3O2.2ClH/c1-5-2-3-6(10(11)12)4-7(5)9-8;;/h2-4,9H,8H2,1H3;2*1H

InChI key: InChIKey=JLQZKPBDQDOPIG-UHFFFAOYSA-N

SMILES: N(N)C1=CC(N(=O)=O)=CC=C1C.Cl

Synonyms:

• Hydrazine, (2-methyl-5-nitrophenyl)-, hydrochloride (1:2)

(2-Methyl-5-nitrophenyl)hydrazine dihydrochloride

CAS: 1221725-20-7

Versatile small molecule scaffold

Formula: C₇H₁₁Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 240.08 g/mol

Ref: 3D-WYB72520