CAS 1221725-29-6

1-Piperazineacetonitrile, α,4-dimethyl-, hydrochloride (1:1)

Description:

1-Piperazineacetonitrile, α,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a nitrile group (-C≡N) attached to the acetonitrile moiety, along with two methyl groups at the α and 4 positions of the piperazine ring, contributing to its unique structural properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for various applications. Typically, such compounds are of interest in medicinal chemistry due to their potential biological activity, including effects on the central nervous system or as intermediates in the synthesis of pharmaceuticals. The presence of the piperazine structure often suggests potential interactions with neurotransmitter receptors. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as regulatory considerations for research and industrial use.

Formula: C₈H₁₅N₃·ClH

InChI: InChI=1S/C8H15N3.ClH/c1-8(7-9)11-5-3-10(2)4-6-11;/h8H,3-6H2,1-2H3;1H

InChI key: InChIKey=HVLHAMGGGXIJHX-UHFFFAOYSA-N

SMILES: C(C#N)(C)N1CCN(C)CC1.Cl

Synonyms:

• 1-Piperazineacetonitrile, α,4-dimethyl-, hydrochloride (1:1)

2-(4-Methylpiperazin-1-yl)propanenitrile hydrochloride

CAS: 1221725-29-6

Versatile small molecule scaffold

Formula: C₈H₁₆ClN₃

Purity: Min. 95%

Molecular weight: 189.68 g/mol

Ref: 3D-WYB72529