CymitQuimica logo

CAS 1221725-37-6

:

N-(2-Cyanoethyl)-N-(4-fluorophenyl)glycine ethyl ester

Description:
N-(2-Cyanoethyl)-N-(4-fluorophenyl)glycine ethyl ester is a chemical compound characterized by its unique structure, which includes a cyanoethyl group and a fluorophenyl moiety attached to a glycine backbone. This compound typically exhibits properties associated with both amino acids and esters, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including nucleophilic substitutions and ester hydrolysis. The presence of the cyano group may impart additional reactivity, making it useful in synthetic organic chemistry. The fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with other molecules. As with many compounds containing functional groups like esters and cyano groups, it may exhibit moderate stability under standard conditions but could be sensitive to hydrolysis or other environmental factors. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research and development.
Formula:C13H15FN2O2
InChI:InChI=1S/C13H15FN2O2/c1-2-18-13(17)10-16(9-3-8-15)12-6-4-11(14)5-7-12/h4-7H,2-3,9-10H2,1H3
InChI key:InChIKey=RPDKBTWXTFVCTF-UHFFFAOYSA-N
SMILES:N(CC(OCC)=O)(CCC#N)C1=CC=C(F)C=C1
Synonyms:
  • N-(2-Cyanoethyl)-N-(4-fluorophenyl)glycine ethyl ester
  • Glycine, N-(2-cyanoethyl)-N-(4-fluorophenyl)-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.