CAS 1221725-47-8

Piperazine, 1-[(2,5-dimethyl-3-thienyl)sulfonyl]-, hydrochloride (1:1)

Description:

Piperazine, 1-[(2,5-dimethyl-3-thienyl)sulfonyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a thienyl group, specifically a 2,5-dimethyl-3-thienyl moiety, contributes to its unique properties, including potential biological activity. The sulfonyl group enhances its solubility and reactivity, making it suitable for various applications in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in water, facilitating its use in pharmaceutical formulations. This compound may exhibit pharmacological effects, potentially acting as an anxiolytic or antidepressant, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it may interact with neurotransmitter systems, but detailed mechanisms of action would require additional research. Overall, this compound represents a class of piperazine derivatives that are of interest in drug development and therapeutic applications.

Formula: C₁₀H₁₆N₂O₂S₂·ClH

InChI: InChI=1S/C10H16N2O2S2.ClH/c1-8-7-10(9(2)15-8)16(13,14)12-5-3-11-4-6-12;/h7,11H,3-6H2,1-2H3;1H

InChI key: InChIKey=RTBNRICETJKJFH-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(C)SC(C)=C1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-[(2,5-dimethyl-3-thienyl)sulfonyl]-, hydrochloride (1:1)

1-[(2,5-Dimethylthiophen-3-yl)sulfonyl]piperazine hydrochloride

CAS: 1221725-47-8

Versatile small molecule scaffold

Formula: C₁₀H₁₇ClN₂O₂S₂

Purity: Min. 95%

Molecular weight: 296.8 g/mol

Ref: 3D-WYB72547