CAS 1221725-56-9

4-Pyridinecarboximidamide, 2-(4-ethyl-1-piperazinyl)-, hydrochloride (1:2)

Description:

4-Pyridinecarboximidamide, 2-(4-ethyl-1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a pyridine ring and a piperazine moiety. The presence of the carboximidamide functional group contributes to its potential as a bioactive molecule. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for various applications in medicinal chemistry and pharmacology. The piperazine ring is known for its ability to interact with biological targets, potentially influencing neurotransmitter systems. The ethyl substitution on the piperazine enhances its lipophilicity, which may affect its pharmacokinetic properties. As with many compounds containing nitrogen heterocycles, it may exhibit basic properties, allowing it to form salts with acids. Overall, this compound's structural features suggest potential utility in drug development, particularly in the context of neuropharmacology or as a scaffold for further chemical modifications. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₂H₁₉N₅·2ClH

InChI: InChI=1S/C12H19N5.2ClH/c1-2-16-5-7-17(8-6-16)11-9-10(12(13)14)3-4-15-11;;/h3-4,9H,2,5-8H2,1H3,(H3,13,14);2*1H

InChI key: InChIKey=XDRIROKUALTYRH-UHFFFAOYSA-N

SMILES: C(=N)(N)C=1C=C(N=CC1)N2CCN(CC)CC2.Cl

Synonyms:

• 4-Pyridinecarboximidamide, 2-(4-ethyl-1-piperazinyl)-, hydrochloride (1:2)

2-(4-Ethylpiperazin-1-yl)pyridine-4-carboximidamide dihydrochloride

CAS: 1221725-56-9

Versatile small molecule scaffold

Formula: C₁₂H₂₁Cl₂N₅

Purity: Min. 95%

Molecular weight: 306.23 g/mol

Ref: 3D-WYB72556