CymitQuimica logo

CAS 1221725-57-0

:

2,2,2-Trifluoroethyl N-(1-methylpropyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(1-methylpropyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound typically exhibits properties associated with both fluorinated compounds and carbamates, such as increased lipophilicity and potential biological activity. The presence of trifluoromethyl groups often enhances the stability and reactivity of the molecule, making it of interest in various applications, including agrochemicals and pharmaceuticals. The carbamate moiety suggests potential use as a pesticide or herbicide, as many carbamate derivatives are known for their effectiveness in these areas. Additionally, the compound may exhibit specific solubility characteristics, influenced by the fluorinated group, which can affect its behavior in biological systems and environmental interactions. Safety and handling considerations are essential, as with many fluorinated compounds, due to potential toxicity and environmental persistence. Overall, 2,2,2-Trifluoroethyl N-(1-methylpropyl)carbamate represents a class of compounds that combine unique chemical properties with potential practical applications.
Formula:C7H12F3NO2
InChI:InChI=1S/C7H12F3NO2/c1-3-5(2)11-6(12)13-4-7(8,9)10/h5H,3-4H2,1-2H3,(H,11,12)
InChI key:InChIKey=CCZXUOWSNIENSE-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)(NC(CC)C)=O
Synonyms:
  • Carbamic acid, N-(1-methylpropyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-(1-methylpropyl)carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.