CAS 1221725-74-1

5-(2-Chloroacetyl)-N,N-dimethyl-3-thiophenecarboxamide

Description:

5-(2-Chloroacetyl)-N,N-dimethyl-3-thiophenecarboxamide is a chemical compound characterized by its unique structure, which includes a thiophene ring, a carboxamide functional group, and a chloroacetyl substituent. The presence of the thiophene ring imparts aromatic properties, while the chloroacetyl group contributes to its reactivity, particularly in nucleophilic substitution reactions. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the thiophene and dimethyl groups, which can influence its solubility in organic solvents. The chloroacetyl moiety may also enhance its potential as a building block in medicinal chemistry, possibly leading to bioactive derivatives. Additionally, the dimethyl substitution on the nitrogen atom of the amide group suggests steric hindrance, which can affect the compound's interaction with biological targets. Overall, this compound's unique structural features may make it of interest in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.

Formula: C₉H₁₀ClNO₂S

InChI: InChI=1S/C9H10ClNO2S/c1-11(2)9(13)6-3-8(14-5-6)7(12)4-10/h3,5H,4H2,1-2H3

InChI key: InChIKey=DPXQZHHTRROBHP-UHFFFAOYSA-N

SMILES: C(N(C)C)(=O)C=1C=C(C(CCl)=O)SC1

Synonyms:

• 3-Thiophenecarboxamide, 5-(2-chloroacetyl)-N,N-dimethyl-
• 5-(2-Chloroacetyl)-N,N-dimethyl-3-thiophenecarboxamide