CAS 1221725-77-4

3-Pyridinecarboximidamide, 6-phenoxy-, hydrochloride (1:1)

Description:

3-Pyridinecarboximidamide, 6-phenoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and carboximidamide functional groups, which contribute to its potential biological activity. The presence of the phenoxy group enhances its lipophilicity, potentially influencing its interaction with biological membranes. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential inhibitor or modulator in biochemical pathways, although specific biological activities would depend on its structure and the context of its use. Its CAS number, 1221725-77-4, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in medicinal chemistry or other fields.

Formula: C₁₂H₁₁N₃O·ClH

InChI: InChI=1S/C12H11N3O.ClH/c13-12(14)9-6-7-11(15-8-9)16-10-4-2-1-3-5-10;/h1-8H,(H3,13,14);1H

InChI key: InChIKey=JKPLVMWVKJOYCY-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(=N)N)C=N1)C2=CC=CC=C2.Cl

Synonyms:

• 3-Pyridinecarboximidamide, 6-phenoxy-, hydrochloride (1:1)

6-Phenoxypyridine-3-carboximidamide hydrochloride

CAS: 1221725-77-4

Versatile small molecule scaffold

Formula: C₁₂H₁₂ClN₃O

Purity: Min. 95%

Molecular weight: 249.69 g/mol

Ref: 3D-WYB72577