CAS 1221725-94-5

2-Thiophenemethanamine, N-(1-methylethyl)-5-(2-methylphenyl)-, hydrochloride (1:1)

Description:

2-Thiophenemethanamine, N-(1-methylethyl)-5-(2-methylphenyl)-, hydrochloride (1:1), with CAS number 1221725-94-5, is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties. The presence of the N-(1-methylethyl) group indicates that it has an isopropyl substituent, enhancing its hydrophobic characteristics. The 5-(2-methylphenyl) substituent introduces additional aromaticity and steric bulk, which can influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit biological activity, potentially interacting with various receptors or enzymes, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and biological activity, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound's unique structure suggests potential utility in drug development or as a research chemical.

Formula: C₁₅H₁₉NS·ClH

InChI: InChI=1S/C15H19NS.ClH/c1-11(2)16-10-13-8-9-15(17-13)14-7-5-4-6-12(14)3;/h4-9,11,16H,10H2,1-3H3;1H

InChI key: InChIKey=DTXMXSPUJWDNRL-UHFFFAOYSA-N

SMILES: CC1=C(C=2SC(CNC(C)C)=CC2)C=CC=C1.Cl

Synonyms:

• 2-Thiophenemethanamine, N-(1-methylethyl)-5-(2-methylphenyl)-, hydrochloride (1:1)

{[5-(2-Methylphenyl)thiophen-2-yl]methyl}(propan-2-yl)amine hydrochloride

CAS: 1221725-94-5

Versatile small molecule scaffold

Formula: C₁₅H₂₀ClNS

Purity: Min. 95%

Molecular weight: 281.8 g/mol

Ref: 3D-WYB72594