CymitQuimica logo

CAS 1221726-01-7

:

[1,2,4]Triazolo[1,5-a]pyrimidine, 5-methyl-7-(1-piperazinyl)-, hydrochloride (1:2)

Description:
[1,2,4]Triazolo[1,5-a]pyrimidine, 5-methyl-7-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique triazole and pyrimidine ring structures, which contribute to its potential biological activity. The presence of a piperazine moiety enhances its pharmacological properties, making it of interest in medicinal chemistry, particularly for its potential as a therapeutic agent. The hydrochloride salt form indicates that the compound is likely soluble in water, which is advantageous for biological assays and formulations. This compound may exhibit various properties such as antimicrobial, antifungal, or antitumor activities, although specific biological effects would depend on further empirical studies. Its molecular structure suggests the possibility of interactions with biological targets, making it a candidate for drug development. As with many synthetic compounds, safety and toxicity profiles would need to be evaluated through rigorous testing. Overall, this compound represents a class of heterocyclic compounds that are valuable in the exploration of new pharmaceuticals.
Formula:C10H14N6·2ClH
InChI:InChI=1S/C10H14N6.2ClH/c1-8-6-9(15-4-2-11-3-5-15)16-10(14-8)12-7-13-16;;/h6-7,11H,2-5H2,1H3;2*1H
InChI key:InChIKey=WKGPTIKLDROTBC-UHFFFAOYSA-N
SMILES:CC=1C=C(N2C(N1)=NC=N2)N3CCNCC3.Cl
Synonyms:
  • [1,2,4]Triazolo[1,5-a]pyrimidine, 5-methyl-7-(1-piperazinyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.