CAS 1221726-04-0

1H-1,2,4-Triazole-5-methanamine, 3-phenyl-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-5-methanamine, 3-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with both amines and triazoles, including potential basicity due to the presence of the amine group. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The phenyl group attached to the triazole structure can influence the compound's reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the phenyl group. As with many triazole derivatives, it may exhibit antifungal or antimicrobial properties, although specific biological activities would depend on further empirical studies. Safety data and handling precautions should be consulted, as with any chemical substance.

Formula: C₉H₁₀N₄·ClH

InChI: InChI=1S/C9H10N4.ClH/c10-6-8-11-9(13-12-8)7-4-2-1-3-5-7;/h1-5H,6,10H2,(H,11,12,13);1H

InChI key: InChIKey=QHLKYMIYCFIAAG-UHFFFAOYSA-N

SMILES: C(N)C=1NC(=NN1)C2=CC=CC=C2.Cl

Synonyms:

• 1H-1,2,4-Triazole-5-methanamine, 3-phenyl-, hydrochloride (1:1)
• (3-Phenyl-1H-1,2,4-triazol-5-yl)methanamine hydrochloride

(3-Phenyl-1H-1,2,4-triazol-5-yl)methanamine hydrochloride

CAS: 1221726-04-0

Versatile small molecule scaffold

Formula: C₉H₁₁ClN₄

Purity: Min. 95%

Molecular weight: 210.66 g/mol

Ref: 3D-WYB72604