CAS 1221726-05-1

Benzenemethanol, α-(aminomethyl)-2-chloro-α-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(aminomethyl)-2-chloro-α-(trifluoromethyl)-, hydrochloride (1:1), with CAS number 1221726-05-1, is a chemical compound characterized by its complex structure that includes a benzene ring, a hydroxymethyl group, and a trifluoromethyl group, along with a chlorine atom. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the amino group suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. The trifluoromethyl group is known for imparting unique electronic properties, which can affect the compound's reactivity and stability. Additionally, the chlorinated moiety may contribute to its lipophilicity and overall pharmacokinetic profile. Overall, this compound's characteristics make it a subject of interest for research in various fields, including pharmaceuticals and agrochemicals, where its specific interactions and effects can be further explored.

Formula: C₉H₉ClF₃NO·ClH

InChI: InChI=1S/C9H9ClF3NO.ClH/c10-7-4-2-1-3-6(7)8(15,5-14)9(11,12)13;/h1-4,15H,5,14H2;1H

InChI key: InChIKey=QGNUUIMSOPLYBL-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(CN)(O)C1=C(Cl)C=CC=C1.Cl

Synonyms:

• Benzenemethanol, α-(aminomethyl)-2-chloro-α-(trifluoromethyl)-, hydrochloride (1:1)

3-Amino-2-(2-chlorophenyl)-1,1,1-trifluoropropan-2-ol hydrochloride

CAS: 1221726-05-1

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₂F₃NO

Purity: Min. 95%

Molecular weight: 276.08 g/mol

Ref: 3D-WYB72605