CymitQuimica logo

CAS 1221726-06-2

:

5-(3-Thienyl)-1,2,4-oxadiazole-3-methanamine

Description:
5-(3-Thienyl)-1,2,4-oxadiazole-3-methanamine is a chemical compound characterized by its unique structure, which includes a thienyl group and an oxadiazole ring. The presence of the oxadiazole moiety contributes to its potential as a bioactive compound, often associated with various pharmacological activities. This compound typically exhibits moderate to high solubility in polar solvents, which can influence its reactivity and interaction with biological systems. The thienyl group may impart specific electronic properties, enhancing its ability to participate in chemical reactions or interact with biological targets. Additionally, the amine functional group can engage in hydrogen bonding, further affecting its solubility and reactivity. The compound's potential applications may span across medicinal chemistry, materials science, and organic synthesis, making it of interest for research and development in these fields. As with many heterocyclic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C7H7N3OS
InChI:InChI=1S/C7H7N3OS/c8-3-6-9-7(11-10-6)5-1-2-12-4-5/h1-2,4H,3,8H2
InChI key:InChIKey=MSFWWMBJLSTUIZ-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(ON1)C=2C=CSC2
Synonyms:
  • 1,2,4-Oxadiazole-3-methanamine, 5-(3-thienyl)-
  • 5-(3-Thienyl)-1,2,4-oxadiazole-3-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.