CAS 1221726-29-9

4-Pyridinecarboximidamide, 2-[(4-methoxyphenyl)methoxy]-, hydrochloride (1:1)

Description:

4-Pyridinecarboximidamide, 2-[(4-methoxyphenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyridine ring and a methoxyphenyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to the presence of the hydrochloride moiety that enhances its solubility. The presence of the carboximidamide functional group suggests potential biological activity, possibly as a pharmaceutical agent or in biochemical applications. Its molecular structure indicates that it may participate in hydrogen bonding, which can influence its reactivity and interactions with biological targets. The compound's CAS number, 1221726-29-9, allows for precise identification in chemical databases, facilitating research and development in various fields, including medicinal chemistry and material science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₄H₁₅N₃O₂·ClH

InChI: InChI=1S/C14H15N3O2.ClH/c1-18-12-4-2-10(3-5-12)9-19-13-8-11(14(15)16)6-7-17-13;/h2-8H,9H2,1H3,(H3,15,16);1H

InChI key: InChIKey=ZMBLGGOQVBKMFP-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(OC)C=C1)C2=CC(C(=N)N)=CC=N2.Cl

Synonyms:

• 4-Pyridinecarboximidamide, 2-[(4-methoxyphenyl)methoxy]-, hydrochloride (1:1)

2-[(4-Methoxyphenyl)methoxy]pyridine-4-carboximidamide hydrochloride

CAS: 1221726-29-9

Versatile small molecule scaffold

Formula: C₁₄H₁₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 293.75 g/mol

Ref: 3D-WYB72629