CAS 1221726-33-5

Benzenecarboximidamide, 3-(3-pyridinylmethoxy)-, hydrochloride (1:3)

Description:

Benzenecarboximidamide, 3-(3-pyridinylmethoxy)-, hydrochloride (1:3) is a chemical compound characterized by its complex structure, which includes a benzenecarboximidamide moiety and a pyridinylmethoxy group. This compound typically appears as a hydrochloride salt, indicating the presence of hydrochloric acid in its formulation, which enhances its solubility in water. The presence of the pyridine ring contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The compound may exhibit characteristics such as moderate to high polarity due to the functional groups present, which can influence its interaction with biological systems. Additionally, the hydrochloride form suggests that it may be stable under certain conditions, making it suitable for various applications in medicinal chemistry and research. Its specific reactivity and interactions would depend on the functional groups and the overall molecular structure, which can be explored further in the context of drug development or synthetic chemistry.

Formula: C₁₃H₁₃N₃O·3ClH

InChI: InChI=1S/C13H13N3O.3ClH/c14-13(15)11-4-1-5-12(7-11)17-9-10-3-2-6-16-8-10;;;/h1-8H,9H2,(H3,14,15);3*1H

InChI key: InChIKey=IFCFFVMUNOSUST-UHFFFAOYSA-N

SMILES: O(CC=1C=CC=NC1)C2=CC(C(=N)N)=CC=C2.Cl

Synonyms:

• Benzenecarboximidamide, 3-(3-pyridinylmethoxy)-, hydrochloride (1:3)

3-(Pyridin-3-ylmethoxy)benzene-1-carboximidamide trihydrochloride

CAS: 1221726-33-5

Versatile small molecule scaffold

Formula: C₁₃H₁₆Cl₃N₃O

Purity: Min. 95%

Molecular weight: 336.6 g/mol

Ref: 3D-WYB72633