CAS 1221728-80-8

Carbamimidothioic acid, N-(2-methoxyethyl)-, dodecyl ester, hydrobromide (1:1)

Description:

Carbamimidothioic acid, N-(2-methoxyethyl)-, dodecyl ester, hydrobromide (1:1) is a chemical compound characterized by its unique structure, which includes a carbamimidothioic acid moiety linked to a dodecyl ester. This compound features a hydrobromide salt form, indicating the presence of bromide ions that can influence its solubility and reactivity. The presence of the dodecyl group suggests that it has hydrophobic properties, making it potentially useful in applications involving surfactants or emulsifiers. The methoxyethyl substituent may enhance its solubility in organic solvents and contribute to its biological activity. As a thioamide derivative, it may exhibit specific reactivity patterns typical of compounds containing sulfur, such as nucleophilicity or coordination with metal ions. The hydrobromide form can also affect the compound's stability and interaction with other substances. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₆H₃₄N₂OS·BrH

InChI: InChI=1S/C16H34N2OS.BrH/c1-3-4-5-6-7-8-9-10-11-12-15-20-16(17)18-13-14-19-2;/h3-15H2,1-2H3,(H2,17,18);1H

InChI key: InChIKey=BVVKOPGXHKEZHQ-UHFFFAOYSA-N

SMILES: S(CCCCCCCCCCCC)C(NCCOC)=N.Br

Synonyms:

• Carbamimidothioic acid, N-(2-methoxyethyl)-, dodecyl ester, hydrobromide (1:1)

N-[Amino(dodecylsulfanyl)methylidene]-2-methoxyethan-1-amine hydrobromide

CAS: 1221728-80-8

Versatile small molecule scaffold

Formula: C₁₆H₃₅BrN₂OS

Purity: Min. 95%

Molecular weight: 383.4 g/mol

Ref: 3D-WYB72880