CAS 1221728-82-0

2-Propen-1-one, 1-(2,5-dimethyl-3-furanyl)-3-hydroxy-, sodium salt (1:1)

Description:

2-Propen-1-one, 1-(2,5-dimethyl-3-furanyl)-3-hydroxy-, sodium salt (1:1), with CAS number 1221728-82-0, is a chemical compound characterized by its unique structure that includes a furan ring and a propenone moiety. This compound typically exhibits properties associated with both furan derivatives and unsaturated carbonyl compounds, such as reactivity in electrophilic addition and potential for polymerization. The presence of the sodium salt form suggests enhanced solubility in polar solvents, which can facilitate its use in various applications, including organic synthesis and potentially in pharmaceuticals. The hydroxyl group contributes to its polarity and may influence its biological activity, making it a candidate for further research in medicinal chemistry. Additionally, the dimethyl substitution on the furan ring may affect its electronic properties and steric hindrance, impacting its reactivity and interactions with other molecules. Overall, this compound represents a blend of structural features that could be explored for diverse chemical applications.

Formula: C₉H₁₀O₃·Na

InChI: InChI=1S/C9H10O3.Na/c1-6-5-8(7(2)12-6)9(11)3-4-10;/h3-5,10H,1-2H3;

InChI key: InChIKey=PAXHLWUMNSQRQI-UHFFFAOYSA-N

SMILES: C(C=CO)(=O)C1=C(C)OC(C)=C1.[Na]

Synonyms:

• 2-Propen-1-one, 1-(2,5-dimethyl-3-furanyl)-3-hydroxy-, sodium salt (1:1)