CAS 1221728-93-3

1-(1-Methyl-1H-pyrazol-4-yl)ethanone oxime

Description:

1-(1-Methyl-1H-pyrazol-4-yl)ethanone oxime, identified by its CAS number 1221728-93-3, is an organic compound characterized by the presence of a pyrazole ring and an oxime functional group. This substance typically exhibits a molecular structure that includes a methyl group attached to the pyrazole, contributing to its unique reactivity and properties. The oxime functional group, derived from the reaction of an aldehyde or ketone with hydroxylamine, imparts specific chemical behavior, including potential for tautomerization and involvement in various chemical reactions such as condensation and nucleophilic addition. The compound may be of interest in fields such as medicinal chemistry and agrochemicals due to its potential biological activity. Additionally, its solubility and stability can vary based on environmental conditions, influencing its applications in synthesis and formulation. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₆H₉N₃O

InChI: InChI=1S/C6H9N3O/c1-5(8-10)6-3-7-9(2)4-6/h3-4,10H,1-2H3

InChI key: InChIKey=NMPHMNPSFXFAKB-UHFFFAOYSA-N

SMILES: C(=NO)(C)C1=CN(C)N=C1

Synonyms:

• 1-(1-Methyl-1H-pyrazol-4-yl)ethanone oxime
• Ethanone, 1-(1-methyl-1H-pyrazol-4-yl)-, oxime

N-[1-(1-Methyl-1H-pyrazol-4-yl)ethylidene]hydroxylamine

CAS: 1221728-93-3

Versatile small molecule scaffold

Formula: C₆H₉N₃O

Purity: Min. 95%

Molecular weight: 139.16 g/mol

Ref: 3D-WYB72893