CAS 1221791-67-8

4-[[(Dimethylamino)carbonyl]oxy]benzeneacetic acid

Description:

4-[[(Dimethylamino)carbonyl]oxy]benzeneacetic acid, also known by its CAS number 1221791-67-8, is a chemical compound characterized by its functional groups and structural features. It contains a benzene ring substituted with a carboxylic acid group and an ester moiety derived from dimethylaminocarbonyl. This compound exhibits properties typical of aromatic acids, including potential acidity due to the carboxylic acid group, which can donate protons in solution. The presence of the dimethylamino group suggests that it may exhibit basic characteristics as well, allowing for potential interactions in various chemical environments. Additionally, the compound's structure may influence its solubility, reactivity, and biological activity, making it of interest in pharmaceutical and chemical research. Its unique combination of functional groups may also impart specific properties such as lipophilicity or hydrophilicity, affecting its behavior in biological systems. Overall, this compound's characteristics make it a subject of interest for further study in medicinal chemistry and related fields.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1S/C11H13NO4/c1-12(2)11(15)16-9-5-3-8(4-6-9)7-10(13)14/h3-6H,7H2,1-2H3,(H,13,14)

InChI key: InChIKey=KGKUAADCNJRCNB-UHFFFAOYSA-N

SMILES: O(C(N(C)C)=O)C1=CC=C(CC(O)=O)C=C1

Synonyms:

• 4-[[(Dimethylamino)carbonyl]oxy]benzeneacetic acid
• Benzeneacetic acid, 4-[[(dimethylamino)carbonyl]oxy]-