CAS 1221791-76-9

6-[(4-Bromophenyl)sulfonyl]-3-pyridinamine

Description:

6-[(4-Bromophenyl)sulfonyl]-3-pyridinamine, identified by its CAS number 1221791-76-9, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a sulfonyl group attached to a bromophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the sulfonamide functional group. The bromine substituent on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the sulfonyl group can impart solubility in polar solvents and may participate in hydrogen bonding, affecting the compound's overall physicochemical properties. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.

Formula: C₁₁H₉BrN₂O₂S

InChI: InChI=1S/C11H9BrN2O2S/c12-8-1-4-10(5-2-8)17(15,16)11-6-3-9(13)7-14-11/h1-7H,13H2

InChI key: InChIKey=ZNCIGKTVKRIHDF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(Br)C=C1)C2=CC=C(N)C=N2

Synonyms:

• 6-[(4-Bromophenyl)sulfonyl]-3-pyridinamine
• 3-Pyridinamine, 6-[(4-bromophenyl)sulfonyl]-

6-[(4-Bromophenyl)sulfonyl]-3-pyridinylamine

CAS: 1221791-76-9

6-[(4-Bromophenyl)sulfonyl]-3-pyridinylamine

Purity: ≥95%

Molecular weight: 313.17g/mol

Ref: 54-OR303877