CAS 1221792-05-7

Ethyl 3-cyano-4,6-dimethyl-2-pyridinecarboxylate

Description:

Ethyl 3-cyano-4,6-dimethyl-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) and an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of two methyl groups at the 4 and 6 positions of the pyridine ring influences its steric and electronic characteristics, potentially enhancing its lipophilicity. Ethyl 3-cyano-4,6-dimethyl-2-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, making it useful in various chemical reactions, including synthesis and as an intermediate in pharmaceuticals or agrochemicals. The compound's unique structure may also impart specific biological activities, although detailed studies would be necessary to elucidate its potential applications in medicinal chemistry or other fields. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1S/C11H12N2O2/c1-4-15-11(14)10-9(6-12)7(2)5-8(3)13-10/h5H,4H2,1-3H3

InChI key: InChIKey=URBXZTDLXQERON-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(C#N)C(C)=CC(C)=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 3-cyano-4,6-dimethyl-, ethyl ester
• Ethyl 3-cyano-4,6-dimethyl-2-pyridinecarboxylate

Ethyl 3-cyano-4,6-dimethyl-2-pyridinecarboxylate

CAS: 1221792-05-7

Ethyl 3-cyano-4,6-dimethyl-2-pyridinecarboxylate

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 204.23g/mol

Ref: 54-OR303636