CAS 1221792-14-8

2-Amino-N-(2-nitrophenyl)benzenemethanamine

Description:

2-Amino-N-(2-nitrophenyl)benzenemethanamine, identified by its CAS number 1221792-14-8, is an organic compound characterized by the presence of an amino group and a nitrophenyl substituent on a benzenemethanamine backbone. This compound typically exhibits properties associated with aromatic amines, including potential solubility in polar solvents and moderate stability under standard conditions. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and interaction with other chemical species. It may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, due to the presence of both amino and nitro functional groups. Additionally, the compound's structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, where derivatives of aromatic amines are often utilized. However, safety considerations must be taken into account, as nitro-substituted compounds can exhibit toxicity and environmental persistence. Proper handling and disposal protocols are essential when working with such substances.

Formula: C₁₃H₁₃N₃O₂

InChI: InChI=1S/C13H13N3O2/c14-11-6-2-1-5-10(11)9-15-12-7-3-4-8-13(12)16(17)18/h1-8,15H,9,14H2

InChI key: InChIKey=NSOUJOMXGTXCKD-UHFFFAOYSA-N

SMILES: N(CC1=C(N)C=CC=C1)C2=C(N(=O)=O)C=CC=C2

Synonyms:

• Benzenemethanamine, 2-amino-N-(2-nitrophenyl)-
• 2-[[(2-Nitrophenyl)amino]methyl]aniline
• 2-Amino-N-(2-nitrophenyl)benzenemethanamine
• 2-[(2-Nitroanilino)methyl]aniline