CAS 1221792-16-0

Methyl 5-methoxy-7-benzoxazolecarboxylate

Description:

Methyl 5-methoxy-7-benzoxazolecarboxylate is an organic compound characterized by its benzoxazole structure, which features a fused benzene and oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential biological activity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Methyl 5-methoxy-7-benzoxazolecarboxylate may be utilized in various applications, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its specific reactivity can be attributed to the functional groups present, allowing for potential derivatization and modification. Additionally, the compound's molecular structure suggests it may exhibit fluorescence or other optical properties, making it of interest in materials science and analytical chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₉NO₄

InChI: InChI=1S/C10H9NO4/c1-13-6-3-7(10(12)14-2)9-8(4-6)11-5-15-9/h3-5H,1-2H3

InChI key: InChIKey=BDEPJHWVIGGFMN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC(OC)=C1)N=CO2

Synonyms:

• 7-Benzoxazolecarboxylic acid, 5-methoxy-, methyl ester
• Methyl 5-methoxy-7-benzoxazolecarboxylate