CAS 1221792-20-6

Methyl 7-methoxy-5-benzoxazolecarboxylate

Description:

Methyl 7-methoxy-5-benzoxazolecarboxylate is an organic compound characterized by its benzoxazole structure, which features a fused benzene and oxazole ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzoxazole moiety. The methoxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Methyl 7-methoxy-5-benzoxazolecarboxylate is likely to be a white to off-white solid, with a moderate melting point and stability under standard laboratory conditions. Its chemical behavior can be influenced by the presence of functional groups, making it a candidate for various synthetic applications, including medicinal chemistry and material science. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₉NO₄

InChI: InChI=1S/C10H9NO4/c1-13-8-4-6(10(12)14-2)3-7-9(8)15-5-11-7/h3-5H,1-2H3

InChI key: InChIKey=CHLOLBJKPXUMIJ-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(C(OC)=O)=C1)N=CO2

Synonyms:

• Methyl 7-methoxy-5-benzoxazolecarboxylate
• 5-Benzoxazolecarboxylic acid, 7-methoxy-, methyl ester