CAS 1221792-21-7

6-Chloro-5-(trifluoromethyl)-2-benzothiazoleacetonitrile

Description:

6-Chloro-5-(trifluoromethyl)-2-benzothiazoleacetonitrile is a chemical compound characterized by its unique structural features, which include a benzothiazole ring system, a chloro substituent, and a trifluoromethyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high lipophilicity and potential biological activity due to the presence of the benzothiazole moiety. The trifluoromethyl group enhances its electron-withdrawing characteristics, which can influence its reactivity and interaction with biological targets. Additionally, the presence of the acetonitrile functional group suggests potential solubility in polar solvents. This compound may be of interest in pharmaceutical research and development, particularly in the context of drug design, due to its potential as a bioactive agent. Its specific applications and behavior in various chemical environments would depend on further studies, including its synthesis, stability, and interaction with other chemical species.

Formula: C₁₀H₄ClF₃N₂S

InChI: InChI=1S/C10H4ClF3N2S/c11-6-4-8-7(3-5(6)10(12,13)14)16-9(17-8)1-2-15/h3-4H,1H2

InChI key: InChIKey=YLGFBDFUSRCUQH-UHFFFAOYSA-N

SMILES: C(C#N)C=1SC=2C(=CC(C(F)(F)F)=C(Cl)C2)N1

Synonyms:

• 2-Benzothiazoleacetonitrile, 6-chloro-5-(trifluoromethyl)-
• 6-Chloro-5-(trifluoromethyl)-2-benzothiazoleacetonitrile