CymitQuimica logo

CAS 1221792-22-8

:

1,9-Dithia-4,12-diazadispiro[4.2.4.2]tetradecane, hydrochloride (1:2)

Description:
1,9-Dithia-4,12-diazadispiro[4.2.4.2]tetradecane, hydrochloride (1:2) is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms. The presence of two sulfur atoms and two nitrogen atoms within its framework contributes to its potential reactivity and biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in polar solvents, making it more amenable for various applications, including medicinal chemistry and material science. The spirocyclic arrangement may impart interesting conformational properties, influencing its interaction with biological targets. Additionally, the compound's structural features suggest potential applications in drug development, particularly in the design of novel therapeutics. However, detailed studies on its pharmacological properties, toxicity, and stability are essential for understanding its full potential and safety profile. As with many specialized compounds, handling and usage should adhere to appropriate safety guidelines due to the presence of nitrogen and sulfur, which can affect biological systems.
Formula:C10H18N2S2·2ClH
InChI:InChI=1S/C10H18N2S2.2ClH/c1-2-10(12-6-8-14-10)4-3-9(1)11-5-7-13-9;;/h11-12H,1-8H2;2*1H
InChI key:InChIKey=XDDMPIDQIKBPJL-UHFFFAOYSA-N
SMILES:C12(CCC3(CC1)NCCS3)NCCS2.Cl
Synonyms:
  • 1,9-Dithia-4,12-diazadispiro[4.2.4.2]tetradecane, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.