CAS 1221792-40-0

1-Thia-4-azaspiro[4.5]decane-8-carbonitrile, 8-phenyl-, hydrochloride (1:1)

Description:

1-Thia-4-azaspiro[4.5]decane-8-carbonitrile, 8-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms within its framework. The presence of a carbonitrile group contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its pharmacokinetic properties. The phenyl group attached to the spiro structure may influence its interaction with biological targets, potentially affecting its efficacy and selectivity. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values. Overall, the compound's structural features suggest potential applications in drug development, particularly in areas requiring novel therapeutic agents.

Formula: C₁₅H₁₈N₂S·ClH

InChI: InChI=1S/C15H18N2S.ClH/c16-12-14(13-4-2-1-3-5-13)6-8-15(9-7-14)17-10-11-18-15;/h1-5,17H,6-11H2;1H

InChI key: InChIKey=YKHGWWYGAWNYJO-UHFFFAOYSA-N

SMILES: C(#N)C1(CCC2(CC1)NCCS2)C3=CC=CC=C3.Cl

Synonyms:

• 1-Thia-4-azaspiro[4.5]decane-8-carbonitrile, 8-phenyl-, hydrochloride (1:1)