CAS 1221792-45-5

Methyl 2,3-dihydro-5-methyl-2-oxo-7-benzoxazolecarboxylate

Description:

Methyl 2,3-dihydro-5-methyl-2-oxo-7-benzoxazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzoxazole ring fused with a carboxylate group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzoxazole moiety, which is known for its applications in pharmaceuticals and agrochemicals. The methyl ester functional group contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the presence of the diketone functionality suggests potential for tautomeric forms, which can affect its chemical behavior. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, this compound may be of interest in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₁₀H₉NO₄

InChI: InChI=1S/C10H9NO4/c1-5-3-6(9(12)14-2)8-7(4-5)11-10(13)15-8/h3-4H,1-2H3,(H,11,13)

InChI key: InChIKey=YCWLXSVGZQETTQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(NC(=O)O2)=CC(C)=C1

Synonyms:

• Methyl 2,3-dihydro-5-methyl-2-oxo-7-benzoxazolecarboxylate
• 7-Benzoxazolecarboxylic acid, 2,3-dihydro-5-methyl-2-oxo-, methyl ester