CAS 1221792-46-6
:5,6-Difluoro-1-methyl-1H-indazol-3-amine
Description:
5,6-Difluoro-1-methyl-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two fluorine atoms at the 5 and 6 positions of the indazole ring contributes to its unique electronic properties and potential reactivity. The methyl group at the 1 position and the amino group at the 3 position enhance its solubility and may influence its biological activity. This compound is often studied in the context of medicinal chemistry, particularly for its potential applications in drug development, as modifications to the indazole structure can lead to compounds with varied pharmacological profiles. Its molecular structure suggests it may interact with biological targets, making it of interest in research related to cancer, inflammation, or other therapeutic areas. As with many fluorinated compounds, it may exhibit increased metabolic stability and altered lipophilicity, which can affect its bioavailability and distribution in biological systems.
Formula:C8H7F2N3
InChI:InChI=1S/C8H7F2N3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12-13/h2-3H,1H3,(H2,11,12)
InChI key:InChIKey=WXLSWUUBKKQGKX-UHFFFAOYSA-N
SMILES:NC=1C=2C(N(C)N1)=CC(F)=C(F)C2
Synonyms:- 5,6-Difluoro-1-methyl-1H-indazol-3-amine
- 1H-Indazol-3-amine, 5,6-difluoro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.