CAS 1221792-57-9

[1,2,4]Triazolo[1,5-a]pyrimidine-2,7-diamine

Description:

[1,2,4]Triazolo[1,5-a]pyrimidine-2,7-diamine is a heterocyclic compound characterized by a fused triazole and pyrimidine ring system. This compound features two amino groups located at the 2 and 7 positions of the pyrimidine ring, which can significantly influence its chemical reactivity and potential biological activity. The presence of these amino groups enhances its solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. The triazole moiety contributes to the compound's stability and can participate in hydrogen bonding, which is crucial for its interactions in biological systems. Additionally, the compound may exhibit various pharmacological properties, including potential anti-cancer or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. Its unique structure allows for potential modifications that could lead to the development of novel therapeutic agents. Overall, [1,2,4]Triazolo[1,5-a]pyrimidine-2,7-diamine represents a valuable scaffold in drug discovery and development.

Formula: C₅H₆N₆

InChI: InChI=1S/C5H6N6/c6-3-1-2-8-5-9-4(7)10-11(3)5/h1-2H,6H2,(H2,7,10)

InChI key: InChIKey=OHGSMAZJGDEVOT-UHFFFAOYSA-N

SMILES: NC=1N2C(=NC(N)=N2)N=CC1

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidine-2,7-diamine