CAS 1221792-62-6

Methyl 2-(chloromethyl)-7-methoxy-5-benzoxazolecarboxylate

Description:

Methyl 2-(chloromethyl)-7-methoxy-5-benzoxazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzoxazole ring, a methoxy group, and a chloromethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The methoxy group may influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the benzoxazole moiety is known for its biological activity, which may suggest potential applications in pharmaceuticals or agrochemicals. The compound's molecular structure allows for various functionalization possibilities, making it a candidate for further chemical modifications. Safety data and handling precautions should be considered, as the chloromethyl group can pose hazards. Overall, this compound's characteristics make it of interest in synthetic organic chemistry and potential applications in medicinal chemistry.

Formula: C₁₁H₁₀ClNO₄

InChI: InChI=1S/C11H10ClNO4/c1-15-8-4-6(11(14)16-2)3-7-10(8)17-9(5-12)13-7/h3-4H,5H2,1-2H3

InChI key: InChIKey=ZSGJZVPUUJKLPG-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(C(OC)=O)=C1)N=C(CCl)O2

Synonyms:

• Methyl 2-(chloromethyl)-7-methoxy-5-benzoxazolecarboxylate
• 5-Benzoxazolecarboxylic acid, 2-(chloromethyl)-7-methoxy-, methyl ester