CAS 1221792-64-8
:5-Bromo-3-cyano-4,6-dimethyl-2-pyridinecarboxylic acid
Description:
5-Bromo-3-cyano-4,6-dimethyl-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with a bromine atom, a cyano group, and two methyl groups. The presence of the carboxylic acid functional group contributes to its acidic properties, making it a potential candidate for various chemical reactions, including esterification and amidation. The bromine substituent can enhance the compound's reactivity, particularly in nucleophilic substitution reactions. The cyano group introduces a polar character, which can influence solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in agrochemicals or as intermediates in organic synthesis. The compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, 5-Bromo-3-cyano-4,6-dimethyl-2-pyridinecarboxylic acid is a versatile compound with significant potential in various chemical and medicinal applications.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-4-6(3-11)8(9(13)14)12-5(2)7(4)10/h1-2H3,(H,13,14)
InChI key:InChIKey=PEMFHBNFHMNPNL-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C(O)=O)N=C(C)C(Br)=C1C
Synonyms:- 5-Bromo-3-cyano-4,6-dimethyl-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 5-bromo-3-cyano-4,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Bromo-3-cyano-4,6-dimethyl-2-pyridinecarboxylic acid
CAS:5-Bromo-3-cyano-4,6-dimethyl-2-pyridinecarboxylic acid
Molecular weight:255.07g/mol
