CymitQuimica logo

CAS 1221792-65-9

:

Methyl 5-bromo-2-methyl-7-benzoxazolecarboxylate

Description:
Methyl 5-bromo-2-methyl-7-benzoxazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzoxazole ring, a bromine substituent, and a carboxylate ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine atom, which can participate in various substitution reactions. The methyl ester group contributes to its solubility in organic solvents and may influence its reactivity in esterification or hydrolysis reactions. Additionally, the presence of the benzoxazole moiety suggests potential applications in pharmaceuticals or agrochemicals, as benzoxazole derivatives are often explored for their biological activities. The compound's molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Overall, Methyl 5-bromo-2-methyl-7-benzoxazolecarboxylate is a compound of interest in both research and industrial applications due to its distinctive chemical properties and potential utility.
Formula:C10H8BrNO3
InChI:InChI=1S/C10H8BrNO3/c1-5-12-8-4-6(11)3-7(9(8)15-5)10(13)14-2/h3-4H,1-2H3
InChI key:InChIKey=MVPHFLJLVCCXGG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(N=C(C)O2)=CC(Br)=C1
Synonyms:
  • Methyl 5-bromo-2-methyl-7-benzoxazolecarboxylate
  • 7-Benzoxazolecarboxylic acid, 5-bromo-2-methyl-, methyl ester
Found 1 products.