CymitQuimica logo

CAS 1221792-75-1

:

Methyl 4-methyl-2-(methylsulfonyl)-5-pyrimidinecarboxylate

Description:
Methyl 4-methyl-2-(methylsulfonyl)-5-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a methylsulfonyl group, which contributes to its polar characteristics and potential solubility in polar solvents. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, including esterification and nucleophilic substitutions. Its methyl substituents enhance its lipophilicity, potentially influencing its biological activity and interactions. The compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Additionally, its molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. As with many pyrimidine derivatives, it may also be involved in biological processes, possibly acting as a ligand or a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H10N2O4S
InChI:InChI=1S/C8H10N2O4S/c1-5-6(7(11)14-2)4-9-8(10-5)15(3,12)13/h4H,1-3H3
InChI key:InChIKey=DAARAGLJRWMQRI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(C)=NC(S(C)(=O)=O)=NC1
Synonyms:
  • Methyl 4-methyl-2-(methylsulfonyl)-5-pyrimidinecarboxylate
  • 5-Pyrimidinecarboxylic acid, 4-methyl-2-(methylsulfonyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.