CAS 1221792-78-4

Methyl 2,3-dihydro-7-methoxy-2-oxo-5-benzoxazolecarboxylate

Description:

Methyl 2,3-dihydro-7-methoxy-2-oxo-5-benzoxazolecarboxylate, identified by its CAS number 1221792-78-4, is a chemical compound that belongs to the class of benzoxazole derivatives. This compound typically exhibits a bicyclic structure, characterized by the presence of a benzoxazole ring fused with a saturated five-membered ring. The methoxy group and the carboxylate moiety contribute to its polar characteristics, potentially enhancing its solubility in organic solvents. The presence of the carbonyl group (oxo) indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Methyl esters like this compound are often used in organic synthesis and may exhibit biological activity, making them of interest in medicinal chemistry. The specific properties, such as melting point, boiling point, and reactivity, would depend on the compound's molecular interactions and the environment in which it is studied. Overall, this compound's unique structure and functional groups suggest potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₀H₉NO₅

InChI: InChI=1S/C10H9NO5/c1-14-7-4-5(9(12)15-2)3-6-8(7)16-10(13)11-6/h3-4H,1-2H3,(H,11,13)

InChI key: InChIKey=BVONGQIOYMDMGS-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(C(OC)=O)=C1)NC(=O)O2

Synonyms:

• Methyl 2,3-dihydro-7-methoxy-2-oxo-5-benzoxazolecarboxylate
• 5-Benzoxazolecarboxylic acid, 2,3-dihydro-7-methoxy-2-oxo-, methyl ester