
CAS 1221792-82-0
:2-[4-(Methylsulfonyl)-1-piperazinyl]phenol
Description:
2-[4-(Methylsulfonyl)-1-piperazinyl]phenol, identified by its CAS number 1221792-82-0, is a chemical compound characterized by its phenolic structure, which includes a piperazine ring substituted with a methylsulfonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group and the sulfonyl (-SO2-) moiety, which can enhance its interaction with biological systems. The piperazine ring contributes to its potential pharmacological activity, making it of interest in medicinal chemistry. The presence of the methylsulfonyl group may also influence its lipophilicity and overall reactivity. Additionally, this compound may exhibit biological activities, including potential antimicrobial or anti-inflammatory effects, although specific biological data would depend on empirical studies. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity with other substances.
Formula:C11H16N2O3S
InChI:InChI=1S/C11H16N2O3S/c1-17(15,16)13-8-6-12(7-9-13)10-4-2-3-5-11(10)14/h2-5,14H,6-9H2,1H3
InChI key:InChIKey=BJVGQDNUYBTDNJ-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1)N2CCN(S(C)(=O)=O)CC2
Synonyms:- Phenol, 2-[4-(methylsulfonyl)-1-piperazinyl]-
- 2-[4-(Methylsulfonyl)-1-piperazinyl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.