CymitQuimica logo

CAS 1221792-87-5

:

3-Methyl-2,5-dioxo-1-imidazolidinepentanoic acid hydrazide

Description:
3-Methyl-2,5-dioxo-1-imidazolidinepentanoic acid hydrazide is a chemical compound characterized by its complex structure, which includes an imidazolidine ring and hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and imidazolidines, such as potential reactivity towards electrophiles and nucleophiles due to the presence of carbonyl groups. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the methyl group suggests that it may have specific steric and electronic effects that influence its reactivity and interaction with biological targets. Additionally, the hydrazide moiety can participate in various chemical reactions, including condensation and hydrazone formation, which are relevant in synthetic organic chemistry. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 3-Methyl-2,5-dioxo-1-imidazolidinepentanoic acid hydrazide represents a unique structure that may have applications in medicinal chemistry and material science.
Formula:C9H16N4O3
InChI:InChI=1S/C9H16N4O3/c1-12-6-8(15)13(9(12)16)5-3-2-4-7(14)11-10/h2-6,10H2,1H3,(H,11,14)
InChI key:InChIKey=UGVPHAXQDZWUCE-UHFFFAOYSA-N
SMILES:C(CCCC(NN)=O)N1C(=O)N(C)CC1=O
Synonyms:
  • 1-Imidazolidinepentanoic acid, 3-methyl-2,5-dioxo-, hydrazide
  • 3-Methyl-2,5-dioxo-1-imidazolidinepentanoic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.