CymitQuimica logo

CAS 1221792-92-2

:

Octahydrospiro[naphthalene-2(1H),2′-thiazolidine]

Description:
Octahydrospiro[naphthalene-2(1H),2′-thiazolidine] is a chemical compound characterized by its unique spirocyclic structure, which combines a naphthalene moiety with a thiazolidine ring. This compound features a bicyclic framework that contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the thiazolidine ring introduces heteroatoms, which can influence the compound's reactivity and interaction with biological systems. Typically, compounds of this nature may exhibit interesting properties such as moderate to high lipophilicity, which can affect their solubility and bioavailability. Additionally, the stereochemistry of the spiro center can lead to distinct conformational isomers, potentially impacting the compound's biological activity. While specific data on its physical properties, such as melting point or boiling point, may not be readily available, the structural characteristics suggest that it could participate in various chemical reactions, making it a candidate for further research in synthetic chemistry and drug development.
Formula:C12H21NS
InChI:InChI=1S/C12H21NS/c1-2-4-11-9-12(13-7-8-14-12)6-5-10(11)3-1/h10-11,13H,1-9H2
InChI key:InChIKey=QGBHEKOPFUSDOP-UHFFFAOYSA-N
SMILES:C12(CC3C(CC1)CCCC3)NCCS2
Synonyms:
  • Octahydrospiro[naphthalene-2(1H),2′-thiazolidine]
  • Spiro[naphthalene-2(1H),2′-thiazolidine], octahydro-
Found 1 products.