CymitQuimica logo

CAS 1221792-94-4

:

8-Oxa-1-thia-4-azaspiro[4.5]decan-3-one

Description:
8-Oxa-1-thia-4-azaspiro[4.5]decan-3-one is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates oxygen, sulfur, and nitrogen atoms within its framework. The compound features a spiro connection between two rings, contributing to its three-dimensional conformation. The presence of the oxo group (C=O) at the 3-position and the combination of heteroatoms (oxygen, sulfur, and nitrogen) in the ring system suggest potential reactivity and biological activity. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure may influence its solubility, stability, and interaction with biological targets. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its identity and purity. Overall, 8-Oxa-1-thia-4-azaspiro[4.5]decan-3-one represents a class of compounds that could be explored for various applications, particularly in drug development and materials science.
Formula:C7H11NO2S
InChI:InChI=1S/C7H11NO2S/c9-6-5-11-7(8-6)1-3-10-4-2-7/h1-5H2,(H,8,9)
InChI key:InChIKey=GDGABQIOYWTEIA-UHFFFAOYSA-N
SMILES:O=C1NC2(SC1)CCOCC2
Synonyms:
  • 8-Oxa-1-thia-4-azaspiro[4.5]decan-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.