CAS 1221792-97-7

5-Bromo-3-iodo-2-methoxybenzoic acid hydrazide

Description:

5-Bromo-3-iodo-2-methoxybenzoic acid hydrazide is a chemical compound characterized by its unique structural features, which include a benzoic acid moiety substituted with bromine and iodine atoms, as well as a methoxy group. This compound belongs to the class of hydrazides, which are derivatives of carboxylic acids where the hydroxyl group is replaced by a hydrazine group. The presence of halogen substituents (bromine and iodine) can significantly influence the compound's reactivity and biological activity, potentially enhancing its utility in medicinal chemistry. The methoxy group contributes to the compound's lipophilicity, which may affect its solubility and permeability in biological systems. Additionally, the hydrazide functional group can participate in various chemical reactions, making this compound a candidate for further synthetic modifications. Its specific applications may include use in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed studies on its biological properties and safety profile would be necessary to fully understand its potential uses.

Formula: C₈H₈BrIN₂O₂

InChI: InChI=1S/C8H8BrIN2O2/c1-14-7-5(8(13)12-11)2-4(9)3-6(7)10/h2-3H,11H2,1H3,(H,12,13)

InChI key: InChIKey=DEGQTRRPXLWDNP-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C(OC)C(I)=CC(Br)=C1

Synonyms:

• 5-Bromo-3-iodo-2-methoxybenzoic acid hydrazide
• Benzoic acid, 5-bromo-3-iodo-2-methoxy-, hydrazide