CAS 1221793-61-8
:1-Bromo-3-(1-methylethoxy)-5-(trifluoromethoxy)benzene
Description:
1-Bromo-3-(1-methylethoxy)-5-(trifluoromethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and two distinct substituents on the benzene ring. The presence of the 1-methylethoxy group introduces an ether functionality, contributing to the compound's overall hydrophobic character, while the trifluoromethoxy group enhances its electron-withdrawing properties due to the electronegativity of the fluorine atoms. This compound is likely to exhibit moderate to high stability under standard conditions, although it may be sensitive to strong nucleophiles or bases due to the presence of the bromine atom, which can undergo nucleophilic substitution reactions. Its unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, where such substituents can influence biological activity or chemical reactivity. Additionally, the trifluoromethoxy group may impart unique solubility characteristics, making it suitable for specific solvent systems. Overall, the compound's properties are influenced by its molecular structure and the interactions of its substituents.
Formula:C10H10BrF3O2
InChI:InChI=1S/C10H10BrF3O2/c1-6(2)15-8-3-7(11)4-9(5-8)16-10(12,13)14/h3-6H,1-2H3
InChI key:InChIKey=BNLQWJWWOBHUGS-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(OC(C)C)=CC(Br)=C1
Synonyms:- 1-Bromo-3-(propan-2-yloxy)-5-(trifluoromethoxy)benzene
- 1-Bromo-3-(1-methylethoxy)-5-(trifluoromethoxy)benzene
- Benzene, 1-bromo-3-(1-methylethoxy)-5-(trifluoromethoxy)-
- 1-Bromo-3-isopropoxy-5-(trifluoromethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
