CymitQuimica logo

CAS 1221793-69-6

:

2-(5-Bromo-2-methoxyphenoxy)acetonitrile

Description:
2-(5-Bromo-2-methoxyphenoxy)acetonitrile is an organic compound characterized by its unique structure, which includes a brominated aromatic ring, a methoxy group, and a nitrile functional group. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methoxy group contributes to the compound's solubility and electronic properties, while the acetonitrile moiety provides a polar functional group that can participate in various chemical reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's properties, such as melting point, boiling point, and solubility, are influenced by its functional groups and overall molecular architecture, which can be critical for its application in various chemical processes.
Formula:C9H8BrNO2
InChI:InChI=1S/C9H8BrNO2/c1-12-8-3-2-7(10)6-9(8)13-5-4-11/h2-3,6H,5H2,1H3
InChI key:InChIKey=PQWGGDKJXBFASE-UHFFFAOYSA-N
SMILES:O(CC#N)C1=C(OC)C=CC(Br)=C1
Synonyms:
  • Acetonitrile, 2-(5-bromo-2-methoxyphenoxy)-
  • 2-(5-Bromo-2-methoxyphenoxy)acetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.