CymitQuimica logo

CAS 1221793-70-9

:

2-(2,6-Dibromo-4-nitrophenoxy)acetonitrile

Description:
2-(2,6-Dibromo-4-nitrophenoxy)acetonitrile is an organic compound characterized by its complex structure, which includes a phenoxy group substituted with bromine and nitro groups, as well as an acetonitrile moiety. The presence of the dibromo and nitro substituents indicates that this compound may exhibit significant reactivity and potential biological activity, often associated with halogenated and nitro compounds. The phenoxy group contributes to its potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Additionally, the acetonitrile functional group suggests that it may have applications in solvent systems or as a building block in the synthesis of more complex molecules. The compound's physical properties, such as solubility, melting point, and boiling point, would depend on its molecular interactions and the presence of functional groups. Safety and handling precautions are essential due to the potential toxicity associated with brominated and nitro compounds. Overall, this compound's unique structure positions it as a subject of interest in both synthetic and medicinal chemistry.
Formula:C8H4Br2N2O3
InChI:InChI=1S/C8H4Br2N2O3/c9-6-3-5(12(13)14)4-7(10)8(6)15-2-1-11/h3-4H,2H2
InChI key:InChIKey=KNKHMLWAWGGBHX-UHFFFAOYSA-N
SMILES:O(CC#N)C1=C(Br)C=C(N(=O)=O)C=C1Br
Synonyms:
  • 2-(2,6-Dibromo-4-nitrophenoxy)acetonitrile
  • Acetonitrile, 2-(2,6-dibromo-4-nitrophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.