CAS 122181-86-6

Methyl 2-amino-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate

Description:

Methyl 2-amino-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate, with the CAS number 122181-86-6, is a chemical compound characterized by its unique bicyclic structure, which includes an isoindole framework. This compound features a carboxylate functional group and an amino group, contributing to its potential reactivity and biological activity. It is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. The presence of the tetrahydroisoindole moiety suggests that it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can influence its behavior in biological systems. Additionally, the compound may undergo various chemical reactions, such as acylation or alkylation, due to the presence of reactive functional groups. Overall, Methyl 2-amino-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate is a compound of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1S/C10H14N2O2/c1-14-10(13)9-8-5-3-2-4-7(8)6-12(9)11/h6H,2-5,11H2,1H3

InChI key: InChIKey=SQIKCWGNFKRUJA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CN1N)CCCC2

Synonyms:

• 1-Carbomethoxy-2-amino-4,5,6,7-tetrahydro-2H-isoindole
• 2H-Isoindole-1-carboxylic acid, 2-amino-4,5,6,7-tetrahydro-, methyl ester
• Methyl 2-amino-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate