CAS 1221818-32-1

1,1-Dimethylethyl 7-bromo-2-azabicyclo[2.2.1]heptane-2-carboxylate

Description:

1,1-Dimethylethyl 7-bromo-2-azabicyclo[2.2.1]heptane-2-carboxylate is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in a seven-membered ring. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, influencing its reactivity and interactions with other molecules. The bromine substituent at the 7-position introduces halogen reactivity, which can be leveraged in various synthetic applications. The carboxylate functional group indicates that the compound can participate in esterification and other reactions typical of carboxylic acids and their derivatives. This compound may exhibit specific solubility characteristics depending on the solvent, and its overall polarity is influenced by the functional groups present. Additionally, the bicyclic framework may impart unique conformational properties, affecting its biological activity and potential applications in medicinal chemistry. Overall, this compound's structural features suggest it could be of interest in organic synthesis and pharmaceutical development.

Formula: C₁₁H₁₈BrNO₂

InChI: InChI=1S/C11H18BrNO2/c1-11(2,3)15-10(14)13-6-7-4-5-8(13)9(7)12/h7-9H,4-6H2,1-3H3

InChI key: InChIKey=QGSRTTBTCLSPDM-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2C(Br)C(C1)CC2

Synonyms:

• 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 7-bromo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 7-bromo-2-azabicyclo[2.2.1]heptane-2-carboxylate

tert-Butyl 7-bromo-3-azabicyclo[2.2.1]heptane-3-carboxylate

CAS: 1221818-32-1

Formula: C₁₁H₁₈BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 276.1701

Ref: IN-DA009CQJ

tert-Butyl 7-bromo-3-azabicyclo[2.2.1]heptane-3-carboxylate

CAS: 1221818-32-1

tert-Butyl 7-bromo-3-azabicyclo[2.2.1]heptane-3-carboxylate

Purity: 95%

Molecular weight: 276.17g/mol

Ref: 54-OR1045603