CymitQuimica logo

CAS 1221819-46-0

:

3-(phenylsulfonylMethylene)oxetane

Description:
3-(Phenylsulfonylmethylene)oxetane is a chemical compound characterized by its oxetane ring, which is a four-membered cyclic ether. The presence of a phenylsulfonyl group introduces significant polarity and reactivity, making this compound of interest in organic synthesis and medicinal chemistry. The oxetane structure contributes to its strain energy, which can facilitate various chemical reactions, including ring-opening reactions. This compound may exhibit unique physical properties such as solubility in organic solvents and potential reactivity with nucleophiles due to the electrophilic nature of the sulfonyl group. Additionally, the phenyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological targets. Overall, 3-(phenylsulfonylmethylene)oxetane is a versatile building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its specific applications and behavior in reactions would depend on the surrounding conditions and the presence of other functional groups.
Formula:C10H10O3S
InChI:InChI=1S/C10H10O3S/c11-14(12,8-9-6-13-7-9)10-4-2-1-3-5-10/h1-5,8H,6-7H2
InChI key:NCHCTLRZIXTLPI-UHFFFAOYSA-N
SMILES:C1C(=CS(=O)(=O)C2=CC=CC=C2)CO1
Synonyms:
  • Oxetane, 3-[(phenylsulfonyl)methylene]-
  • 3-(Benzenesulfonylmethylene)oxetane
  • 3-(phenylsulfonylMethylene)oxetane
  • 3-[(Phenylsulphonyl)methylidene]oxetane
  • 3-[(benzenesulfonyl)methylidene]oxetane
  • 3-((Phenylsulfonyl)
Found 4 products.