CymitQuimica logo

CAS 1221820-86-5

:

1-Methyl-5-(4-methyl-2-thiazolyl)-2,4(1H,3H)-pyrimidinedione

Description:
1-Methyl-5-(4-methyl-2-thiazolyl)-2,4(1H,3H)-pyrimidinedione, identified by its CAS number 1221820-86-5, is a chemical compound that belongs to the class of pyrimidinediones. This substance features a pyrimidine ring substituted with a methyl group and a thiazole moiety, which contributes to its unique chemical properties. The presence of the thiazole ring enhances its potential biological activity, making it of interest in pharmaceutical research. Typically, compounds of this nature may exhibit various biological activities, including antimicrobial or anticancer properties, although specific activities would depend on further empirical studies. The molecular structure suggests potential for hydrogen bonding and interactions with biological targets, which is crucial for its function in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular geometry. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.
Formula:C9H9N3O2S
InChI:InChI=1S/C9H9N3O2S/c1-5-4-15-8(10-5)6-3-12(2)9(14)11-7(6)13/h3-4H,1-2H3,(H,11,13,14)
InChI key:InChIKey=FDMIAHXVJGSECA-UHFFFAOYSA-N
SMILES:O=C1C(C=2SC=C(C)N2)=CN(C)C(=O)N1
Synonyms:
  • 1-Methyl-5-(4-methyl-2-thiazolyl)-2,4(1H,3H)-pyrimidinedione
  • 2,4(1H,3H)-Pyrimidinedione, 1-methyl-5-(4-methyl-2-thiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.