CAS 122185-09-5
:3,3,14,14-Tetramethoxy-2,15-dioxa-3,14-disilahexadecane
Description:
3,3,14,14-Tetramethoxy-2,15-dioxa-3,14-disilahexadecane is a siloxane compound characterized by its unique structure, which includes both silicon and oxygen atoms integrated into its backbone. This compound features two silane groups and multiple methoxy functional groups, contributing to its potential applications in materials science and organic synthesis. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity, making it useful in various chemical reactions, including polymerization and cross-linking processes. Additionally, the dioxa and disila components suggest that it may exhibit interesting properties related to flexibility and thermal stability. Its molecular structure may also impart unique optical or electronic properties, making it a candidate for use in advanced materials, such as coatings or composites. Overall, 3,3,14,14-Tetramethoxy-2,15-dioxa-3,14-disilahexadecane represents a versatile compound with potential applications in both industrial and research settings.
Formula:C16H38O6Si2
InChI:InChI=1/C16H38O6Si2/c1-17-23(18-2,19-3)15-13-11-9-7-8-10-12-14-16-24(20-4,21-5)22-6/h7-16H2,1-6H3
InChI key:InChIKey=JFFBPULXPLWPAA-UHFFFAOYSA-N
SMILES:[Si](CCCCCCCCCC[Si](OC)(OC)OC)(OC)(OC)OC
Synonyms:- 1,10-Bis(trimethoxysilyl)decane
- 2,15-Dioxa-3,14-disilahexadecane, 3,3,14,14-tetramethoxy-
- 3,3,14,14-Tetramethoxy-2,15-dioxa-3,14-disilahexadecane
- Kbm 3106
- 1,10-Bis-trimethoxysilyldecane
- trimethoxy(10-trimethoxysilyldecyl)silane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,3,14,14-Tetramethoxy-2,15-dioxa-3,14-disilahexadecane
CAS:Formula:C16H38O6Si2Molecular weight:382.6403
